triacetin


1,3-bis(acetyloxy)propan-2-yl acetate; 1,3-diacetyloxypropan-2-yl acetate; glycerol triacetate; glyceryl triacetate; 1,2,3-propanetriol triacetate; propane-1,2,3-triyl triacetate; triacetin; triacetyl 1,2,3-propantriol
Links:📏 NIST, 📖 PubMed,
📖Houben-Weyl, 2. Band (Triacetin); p. 486, 520, 530, 541,
MeSH:Anti-Infective Agents; Solvents
CAS RN:[102-76-1]
Formula:C9H14O6; 218.21 g/mol
InChiKey:URAYPUMNDPQOKB-UHFFFAOYSA-N
SMILES:O=C(OCC(OC(=O)C)COC(=O)C)C
Molecular structure of triacetin
Use:camphor substitute for nitrocellulose industries; perfume fixative; plasticizer
Toxicology (LD50):2 670 mg/Kg (mouse, sc); 3 250 mg/Kg(rat, sc)
Density:1.156 g/mL
Molar volume:188.7 mL/mol
Refractive index:1.428
Molecular refractive power:48.55 mL/mol
Dielectric constant:7.01
Dipole moment:2.73 D
Melting point:3 °C
Boiling point:259 °C
Log10 partition octanol / water:0.25
Dimroth ET:40.4
Hildebrant solubility parameter (δ):10.3

Isomers

λ-camphoronic acid
Molecular structure of l-camphoronic acid
dimethyl (4R,5R)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate
Molecular structure of dimethyl (4R,5R)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate
dimethyl (4S,5S)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate
Molecular structure of dimethyl (4S,5S)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate
5,6-O-isopropylidene-L-gulonic acid γ-lactone
Molecular structure of 5,6-O-isopropylidene-L-gulonic acid g-lactone
triacetin
Molecular structure of triacetin